C24H20ClIN6O3 — CID 6322985
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 6322985) has the molecular formula C24H20ClIN6O3 and a molecular weight of 602.82 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6322985 |
| Molecular Formula | C24H20ClIN6O3 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.03 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2nnc(-c3ccccc3)n2)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20ClIN6O3/c1-34-21-12-17(11-20(26)23(21)35-15-16-7-9-19(25)10-8-16)13-27-28-22(33)14-32-30-24(29-31-32)18-5-3-2-4-6-18/h2-13H,14-15H2,1H3,(H,28,33)/b27-13+ |
| InChIKey | SXUWKJKLJLHFOU-UVHMKAGCSA-N |
| XLogP | 4.34 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|