C19H19IN6O3 — CID 5435384
N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 5435384) has the molecular formula C19H19IN6O3 and a molecular weight of 506.30 g/mol. Its IUPAC name is N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5435384 |
| Molecular Formula | C19H19IN6O3 |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | N-[(Z)-(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | CCOc1c(I)cc(/C=N\NC(=O)Cn2nnc(-c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C19H19IN6O3/c1-3-29-18-15(20)9-13(10-16(18)28-2)11-21-22-17(27)12-26-24-19(23-25-26)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,22,27)/b21-11- |
| InChIKey | UCUAXILRXGZBFM-NHDPSOOVSA-N |
| XLogP | 2.50 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|