C16H15ClIN5O4 — CID 135699769
1-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitroguanidine (PubChem CID 135699769) has the molecular formula C16H15ClIN5O4 and a molecular weight of 503.68 g/mol. Its IUPAC name is 1-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitroguanidine.
| Compound Name | 1-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitroguanidine |
|---|---|
| PubChem CID | 135699769 |
| Molecular Formula | C16H15ClIN5O4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 1-[(E)-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]methylideneamino]-2-nitroguanidine |
| SMILES | COc1cc(/C=N/N/C(N)=N\[N+](=O)[O-])cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClIN5O4/c1-26-14-7-11(8-20-21-16(19)22-23(24)25)6-13(18)15(14)27-9-10-2-4-12(17)5-3-10/h2-8H,9H2,1H3,(H3,19,21,22)/b20-8+ |
| InChIKey | OIMADDFFKOKFRJ-DNTJNYDQSA-N |
| XLogP | 2.96 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|