C17H15ClINO3 — CID 91685137
(E)-3-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enamide (PubChem CID 91685137) has the molecular formula C17H15ClINO3 and a molecular weight of 443.67 g/mol. Its IUPAC name is (E)-3-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91685137 |
| Molecular Formula | C17H15ClINO3 |
| Molecular Weight | 443.67 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | (E)-3-[4-[(4-chlorophenyl)methoxy]-3-iodo-5-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(N)=O)cc(I)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClINO3/c1-22-15-9-12(4-7-16(20)21)8-14(19)17(15)23-10-11-2-5-13(18)6-3-11/h2-9H,10H2,1H3,(H2,20,21)/b7-4+ |
| InChIKey | TYGZBXZLDRDMKT-QPJJXVBHSA-N |
| XLogP | 4.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|