C22H19BrN4O4 — CID 126389209
2-anilino-N-[(Z)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126389209) has the molecular formula C22H19BrN4O4 and a molecular weight of 483.32 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126389209 |
| Molecular Formula | C22H19BrN4O4 |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-anilino-N-[(Z)-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CNc1ccccc1)N/N=C\c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C22H19BrN4O4/c23-20-12-17(13-25-26-22(28)14-24-18-4-2-1-3-5-18)8-11-21(20)31-15-16-6-9-19(10-7-16)27(29)30/h1-13,24H,14-15H2,(H,26,28)/b25-13- |
| InChIKey | DTFGNICJKYOADX-MXAYSNPKSA-N |
| XLogP | 4.50 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|