C19H17Cl2N5O3S — CID 5339960
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 5339960) has the molecular formula C19H17Cl2N5O3S and a molecular weight of 466.35 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5339960 |
| Molecular Formula | C19H17Cl2N5O3S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2nnc(N)s2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H17Cl2N5O3S/c1-28-16-6-11(9-23-24-17(27)8-18-25-26-19(22)30-18)2-5-15(16)29-10-12-3-4-13(20)7-14(12)21/h2-7,9H,8,10H2,1H3,(H2,22,26)(H,24,27)/b23-9+ |
| InChIKey | VWELLWOJZMVTLR-NUGSKGIGSA-N |
| XLogP | 3.71 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|