C19H18FN5O3S — CID 6862608
2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 6862608) has the molecular formula C19H18FN5O3S and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6862608 |
| Molecular Formula | C19H18FN5O3S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cc2nnc(N)s2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN5O3S/c1-27-16-8-13(10-22-23-17(26)9-18-24-25-19(21)29-18)4-7-15(16)28-11-12-2-5-14(20)6-3-12/h2-8,10H,9,11H2,1H3,(H2,21,25)(H,23,26)/b22-10+ |
| InChIKey | COGOVVCXIJXLGB-LSHDLFTRSA-N |
| XLogP | 2.54 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|