C23H26BrN5O3S2 — CID 19204485
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-5-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 19204485) has the molecular formula C23H26BrN5O3S2 and a molecular weight of 564.53 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-5-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-5-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 19204485 |
| Molecular Formula | C23H26BrN5O3S2 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[[3-bromo-5-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)CSc2nnc(N)s2)cc(Br)c1OCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C23H26BrN5O3S2/c1-5-31-19-9-16(10-26-27-20(30)12-33-23-29-28-22(25)34-23)8-18(24)21(19)32-11-17-7-14(3)13(2)6-15(17)4/h6-10H,5,11-12H2,1-4H3,(H2,25,28)(H,27,30) |
| InChIKey | UJLWAGKQUASKHF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|