C12H10Br2N4O2S2 — CID 135933652
N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 135933652) has the molecular formula C12H10Br2N4O2S2 and a molecular weight of 466.18 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135933652 |
| Molecular Formula | C12H10Br2N4O2S2 |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 463.86 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)N/N=C\c2cc(Br)c(O)c(Br)c2)s1 |
| InChI | InChI=1S/C12H10Br2N4O2S2/c1-6-16-18-12(22-6)21-5-10(19)17-15-4-7-2-8(13)11(20)9(14)3-7/h2-4,20H,5H2,1H3,(H,17,19)/b15-4- |
| InChIKey | VYYGKJVXZRYRCQ-TVPGTPATSA-N |
| XLogP | 3.32 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|