C19H17FN4O2S2 — CID 6282245
N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 6282245) has the molecular formula C19H17FN4O2S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6282245 |
| Molecular Formula | C19H17FN4O2S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nnc(SCC(=O)N/N=C\c2ccc(OCc3ccc(F)cc3)cc2)s1 |
| InChI | InChI=1S/C19H17FN4O2S2/c1-13-22-24-19(28-13)27-12-18(25)23-21-10-14-4-8-17(9-5-14)26-11-15-2-6-16(20)7-3-15/h2-10H,11-12H2,1H3,(H,23,25)/b21-10- |
| InChIKey | RGRQLDONZZAZPU-FBHDLOMBSA-N |
| XLogP | 3.81 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|