C16H14FN5O3S2 — CID 17048004
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]acetamide (PubChem CID 17048004) has the molecular formula C16H14FN5O3S2 and a molecular weight of 407.45 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 17048004 |
| Molecular Formula | C16H14FN5O3S2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(4-fluorophenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
| SMILES | Nc1nnc(SCC(=O)N/N=C/c2ccc(OCc3ccc(F)cc3)o2)s1 |
| InChI | InChI=1S/C16H14FN5O3S2/c17-11-3-1-10(2-4-11)8-24-14-6-5-12(25-14)7-19-20-13(23)9-26-16-22-21-15(18)27-16/h1-7H,8-9H2,(H2,18,21)(H,20,23)/b19-7+ |
| InChIKey | IIEBHYLGYITYGF-FBCYGCLPSA-N |
| XLogP | 2.67 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|