C17H16ClN5O3S2 — CID 17048047
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]acetamide (PubChem CID 17048047) has the molecular formula C17H16ClN5O3S2 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 17048047 |
| Molecular Formula | C17H16ClN5O3S2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[(E)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1cccc(Cl)c1COc1ccc(/C=N/NC(=O)CSc2nnc(N)s2)o1 |
| InChI | InChI=1S/C17H16ClN5O3S2/c1-10-3-2-4-13(18)12(10)8-25-15-6-5-11(26-15)7-20-21-14(24)9-27-17-23-22-16(19)28-17/h2-7H,8-9H2,1H3,(H2,19,22)(H,21,24)/b20-7+ |
| InChIKey | BTAPFRMVFIMRKE-IFRROFPPSA-N |
| XLogP | 3.50 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|