C28H23ClN6O3S — CID 98454739
N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 98454739) has the molecular formula C28H23ClN6O3S and a molecular weight of 559.05 g/mol. Its IUPAC name is N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 98454739 |
| Molecular Formula | C28H23ClN6O3S |
| Molecular Weight | 559.05 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cccc(Cl)c1COc1ccc(/C=N\NC(=O)CSc2nnc(-c3cccnc3)n2-c2ccccc2)o1 |
| InChI | InChI=1S/C28H23ClN6O3S/c1-19-7-5-11-24(29)23(19)17-37-26-13-12-22(38-26)16-31-32-25(36)18-39-28-34-33-27(20-8-6-14-30-15-20)35(28)21-9-3-2-4-10-21/h2-16H,17-18H2,1H3,(H,32,36)/b31-16- |
| InChIKey | WGNAXMOGFPAXEN-ACXHZZMFSA-N |
| XLogP | 5.71 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.05 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|