C26H19BrN6O2S — CID 4088796
N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 4088796) has the molecular formula C26H19BrN6O2S and a molecular weight of 559.45 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4088796 |
| Molecular Formula | C26H19BrN6O2S |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(4-phenyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1-c1ccccc1)NN=Cc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C26H19BrN6O2S/c27-20-8-6-18(7-9-20)23-11-10-22(35-23)16-29-30-24(34)17-36-26-32-31-25(19-12-14-28-15-13-19)33(26)21-4-2-1-3-5-21/h1-16H,17H2,(H,30,34) |
| InChIKey | JNOIEAHIVAETAO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|