C17H16ClN5O3S — CID 41177676
N-[(Z)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 41177676) has the molecular formula C17H16ClN5O3S and a molecular weight of 405.87 g/mol. Its IUPAC name is N-[(Z)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-[(Z)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 41177676 |
| Molecular Formula | C17H16ClN5O3S |
| Molecular Weight | 405.87 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | N-[(Z)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | Cc1cccc(Cl)c1OCc1ccc(/C=N\NC(=O)CSc2ncn[nH]2)o1 |
| InChI | InChI=1S/C17H16ClN5O3S/c1-11-3-2-4-14(18)16(11)25-8-13-6-5-12(26-13)7-20-22-15(24)9-27-17-19-10-21-23-17/h2-7,10H,8-9H2,1H3,(H,22,24)(H,19,21,23)/b20-7- |
| InChIKey | VUZZSKJSPJBEFY-SCDVKCJHSA-N |
| XLogP | 3.18 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|