C24H22ClN3O4 — CID 17132428
N-[(E)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 17132428) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-[(E)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(E)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 17132428 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[(E)-[5-[(2-chloro-6-methylphenoxy)methyl]furan-2-yl]methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1cccc(Cl)c1OCc1ccc(/C=N/NC(=O)c2cccc(N3CCCC3=O)c2)o1 |
| InChI | InChI=1S/C24H22ClN3O4/c1-16-5-2-8-21(25)23(16)31-15-20-11-10-19(32-20)14-26-27-24(30)17-6-3-7-18(13-17)28-12-4-9-22(28)29/h2-3,5-8,10-11,13-14H,4,9,12,15H2,1H3,(H,27,30)/b26-14+ |
| InChIKey | JBBRVMINNVNPSB-VULFUBBASA-N |
| XLogP | 4.71 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|