C18H17ClN2O4S — CID 110166697
N-(3-chloro-2-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 110166697) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 110166697 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)sulfonyl-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)NC(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H17ClN2O4S/c1-12-15(19)7-3-8-16(12)26(24,25)20-18(23)13-5-2-6-14(11-13)21-10-4-9-17(21)22/h2-3,5-8,11H,4,9-10H2,1H3,(H,20,23) |
| InChIKey | IJXDDPJOFCNGEW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |