C18H16N4O5 — CID 135421588
N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 135421588) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 135421588 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(N/N=C/c1cc([N+](=O)[O-])ccc1O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H16N4O5/c23-16-7-6-15(22(26)27)10-13(16)11-19-20-18(25)12-3-1-4-14(9-12)21-8-2-5-17(21)24/h1,3-4,6-7,9-11,23H,2,5,8H2,(H,20,25)/b19-11+ |
| InChIKey | LQSARCWOKLSTSM-YBFXNURJSA-N |
| XLogP | 2.19 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|