C23H23BrClN3O3 — CID 28821792
4-(4-bromoanilino)-N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]butanamide (PubChem CID 28821792) has the molecular formula C23H23BrClN3O3 and a molecular weight of 504.81 g/mol. Its IUPAC name is 4-(4-bromoanilino)-N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]butanamide.
| Compound Name | 4-(4-bromoanilino)-N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]butanamide |
|---|---|
| PubChem CID | 28821792 |
| Molecular Formula | C23H23BrClN3O3 |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 4-(4-bromoanilino)-N-[(Z)-[5-[(2-chloro-6-methylphenyl)methoxy]furan-2-yl]methylideneamino]butanamide |
| SMILES | Cc1cccc(Cl)c1COc1ccc(/C=N\NC(=O)CCCNc2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C23H23BrClN3O3/c1-16-4-2-5-21(25)20(16)15-30-23-12-11-19(31-23)14-27-28-22(29)6-3-13-26-18-9-7-17(24)8-10-18/h2,4-5,7-12,14,26H,3,6,13,15H2,1H3,(H,28,29)/b27-14- |
| InChIKey | OBNAETQVGVONEH-VYYCAZPPSA-N |
| XLogP | 5.93 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|