C10H14N6O2S3 — CID 4170580
N-(ethylideneamino)-2-[[5-[2-(2-ethylidenehydrazinyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 4170580) has the molecular formula C10H14N6O2S3 and a molecular weight of 346.46 g/mol. Its IUPAC name is N-(ethylideneamino)-2-[[5-[2-(2-ethylidenehydrazinyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(ethylideneamino)-2-[[5-[2-(2-ethylidenehydrazinyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4170580 |
| Molecular Formula | C10H14N6O2S3 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(ethylideneamino)-2-[[5-[2-(2-ethylidenehydrazinyl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CC=NNC(=O)CSc1nnc(SCC(=O)NN=CC)s1 |
| InChI | InChI=1S/C10H14N6O2S3/c1-3-11-13-7(17)5-19-9-15-16-10(21-9)20-6-8(18)14-12-4-2/h3-4H,5-6H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | DEXKUTWDPCSORM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|