C19H15ClN4O5S2 — CID 135827350
2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135827350) has the molecular formula C19H15ClN4O5S2 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135827350 |
| Molecular Formula | C19H15ClN4O5S2 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]sulfanyl]-N-[(E)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(/C=N/NC(=O)CSc2nc(-c3ccc(Cl)cc3)cs2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H15ClN4O5S2/c1-29-16-7-11(6-15(18(16)26)24(27)28)8-21-23-17(25)10-31-19-22-14(9-30-19)12-2-4-13(20)5-3-12/h2-9,26H,10H2,1H3,(H,23,25)/b21-8+ |
| InChIKey | LHXNDJKQNXLABD-ODCIPOBUSA-N |
| XLogP | 4.33 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|