C19H17N3O3S2 — CID 135827343
N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 135827343) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135827343 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1cccc(/C=N/NC(=O)CSc2nc(-c3ccccc3)cs2)c1O |
| InChI | InChI=1S/C19H17N3O3S2/c1-25-16-9-5-8-14(18(16)24)10-20-22-17(23)12-27-19-21-15(11-26-19)13-6-3-2-4-7-13/h2-11,24H,12H2,1H3,(H,22,23)/b20-10+ |
| InChIKey | VGBQLQCSVXRFRB-KEBDBYFISA-N |
| XLogP | 3.77 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|