C30H26Cl2N2O4 — CID 3365673
N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 3365673) has the molecular formula C30H26Cl2N2O4 and a molecular weight of 549.45 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3365673 |
| Molecular Formula | C30H26Cl2N2O4 |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | C=CCc1cc(C=NNC(=O)c2cc3ccccc3cc2O)cc(OCC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H26Cl2N2O4/c1-3-7-22-12-19(13-28(37-4-2)29(22)38-18-23-10-11-24(31)16-26(23)32)17-33-34-30(36)25-14-20-8-5-6-9-21(20)15-27(25)35/h3,5-6,8-17,35H,1,4,7,18H2,2H3,(H,34,36) |
| InChIKey | OKEDIQAHRRXLCK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|