C24H21ClFIN2O3 — CID 126061952
3-chloro-N-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-4-methylbenzamide (PubChem CID 126061952) has the molecular formula C24H21ClFIN2O3 and a molecular weight of 566.80 g/mol. Its IUPAC name is 3-chloro-N-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-4-methylbenzamide.
| Compound Name | 3-chloro-N-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 126061952 |
| Molecular Formula | C24H21ClFIN2O3 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | 3-chloro-N-[(Z)-[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-iodophenyl]methylideneamino]-4-methylbenzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccc(C)c(Cl)c2)cc(I)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H21ClFIN2O3/c1-3-31-22-11-16(13-28-29-24(30)17-9-8-15(2)19(25)12-17)10-21(27)23(22)32-14-18-6-4-5-7-20(18)26/h4-13H,3,14H2,1-2H3,(H,29,30)/b28-13- |
| InChIKey | ZIPYJTTWPLVABI-QDTIIGTASA-N |
| XLogP | 6.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|