C23H28ClN3O6 — CID 163329179
4-[[2-ethoxy-4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid;hydrochloride (PubChem CID 163329179) has the molecular formula C23H28ClN3O6 and a molecular weight of 477.95 g/mol. Its IUPAC name is 4-[[2-ethoxy-4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[2-ethoxy-4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 163329179 |
| Molecular Formula | C23H28ClN3O6 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 4-[[2-ethoxy-4-[(E)-[(2-morpholin-4-ylacetyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid;hydrochloride |
| SMILES | CCOc1cc(/C=N/NC(=O)CN2CCOCC2)ccc1OCc1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/C23H27N3O6.ClH/c1-2-31-21-13-18(14-24-25-22(27)15-26-9-11-30-12-10-26)5-8-20(21)32-16-17-3-6-19(7-4-17)23(28)29;/h3-8,13-14H,2,9-12,15-16H2,1H3,(H,25,27)(H,28,29);1H/b24-14+; |
| InChIKey | UWBWNYOYOHOVIH-SXMBIPSUSA-N |
| XLogP | 2.57 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|