C20H21IN4O5 — CID 126001819
N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 126001819) has the molecular formula C20H21IN4O5 and a molecular weight of 524.32 g/mol. Its IUPAC name is N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 126001819 |
| Molecular Formula | C20H21IN4O5 |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C/c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(I)c1 |
| InChI | InChI=1S/C20H21IN4O5/c21-18-11-16(12-22-23-20(26)13-24-7-9-29-10-8-24)3-6-19(18)30-14-15-1-4-17(5-2-15)25(27)28/h1-6,11-12H,7-10,13-14H2,(H,23,26)/b22-12+ |
| InChIKey | LBFBKKOAYKDGSS-WSDLNYQXSA-N |
| XLogP | 2.56 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|