C25H20IN3O6 — CID 126193252
5-ethoxy-N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126193252) has the molecular formula C25H20IN3O6 and a molecular weight of 585.35 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193252 |
| Molecular Formula | C25H20IN3O6 |
| Molecular Weight | 585.35 g/mol |
| Exact Mass | 585.04 |
| IUPAC Name | 5-ethoxy-N-[(E)-[3-iodo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3ccc(OCc4ccc([N+](=O)[O-])cc4)c(I)c3)cc2c1 |
| InChI | InChI=1S/C25H20IN3O6/c1-2-33-20-8-10-22-18(12-20)13-24(35-22)25(30)28-27-14-17-5-9-23(21(26)11-17)34-15-16-3-6-19(7-4-16)29(31)32/h3-14H,2,15H2,1H3,(H,28,30)/b27-14+ |
| InChIKey | KSLYJXAXWFNUKS-MZJWZYIUSA-N |
| XLogP | 5.69 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|