C26H22IN3O7 — CID 126193933
5-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126193933) has the molecular formula C26H22IN3O7 and a molecular weight of 615.38 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193933 |
| Molecular Formula | C26H22IN3O7 |
| Molecular Weight | 615.38 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | 5-ethoxy-N-[(E)-[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(I)c(OCc4ccc([N+](=O)[O-])cc4)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C26H22IN3O7/c1-3-35-20-8-9-22-18(12-20)13-24(37-22)26(31)29-28-14-17-10-21(27)25(23(11-17)34-2)36-15-16-4-6-19(7-5-16)30(32)33/h4-14H,3,15H2,1-2H3,(H,29,31)/b28-14+ |
| InChIKey | TWDNSFICAGGXFD-CCVNUDIWSA-N |
| XLogP | 5.70 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|