C29H27N3O7 — CID 126193778
5-ethoxy-N-[(E)-[3-methoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126193778) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-[3-methoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(E)-[3-methoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126193778 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 5-ethoxy-N-[(E)-[3-methoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc3cc(OCC)ccc3o2)cc(OC)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27N3O7/c1-4-7-21-12-20(14-26(36-3)28(21)38-18-19-8-6-9-23(13-19)32(34)35)17-30-31-29(33)27-16-22-15-24(37-5-2)10-11-25(22)39-27/h4,6,8-17H,1,5,7,18H2,2-3H3,(H,31,33)/b30-17+ |
| InChIKey | RPDSLTMBZZHXTB-OCSSWDANSA-N |
| XLogP | 5.82 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|