C33H30N2O5 — CID 126194455
5-ethoxy-N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 126194455) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is 5-ethoxy-N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-ethoxy-N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126194455 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 5-ethoxy-N-[(E)-[3-methoxy-4-(naphthalen-1-ylmethoxy)-5-prop-2-enylphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | C=CCc1cc(/C=N/NC(=O)c2cc3cc(OCC)ccc3o2)cc(OC)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C33H30N2O5/c1-4-9-24-16-22(20-34-35-33(36)31-19-26-18-27(38-5-2)14-15-29(26)40-31)17-30(37-3)32(24)39-21-25-12-8-11-23-10-6-7-13-28(23)25/h4,6-8,10-20H,1,5,9,21H2,2-3H3,(H,35,36)/b34-20+ |
| InChIKey | XMYHGEVHDXUZEI-QXUDOOCXSA-N |
| XLogP | 7.06 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|