C26H22ClFN2O5 — CID 126192877
N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126192877) has the molecular formula C26H22ClFN2O5 and a molecular weight of 496.92 g/mol. Its IUPAC name is N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126192877 |
| Molecular Formula | C26H22ClFN2O5 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[(E)-[3-chloro-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Cl)c(OCc4cccc(F)c4)c(OC)c3)cc2c1 |
| InChI | InChI=1S/C26H22ClFN2O5/c1-3-33-20-7-8-22-18(12-20)13-24(35-22)26(31)30-29-14-17-10-21(27)25(23(11-17)32-2)34-15-16-5-4-6-19(28)9-16/h4-14H,3,15H2,1-2H3,(H,30,31)/b29-14+ |
| InChIKey | FSCFWLUMAKVSNB-IPPBACCNSA-N |
| XLogP | 5.98 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|