C25H20BrFN2O4 — CID 126189656
N-[(E)-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide (PubChem CID 126189656) has the molecular formula C25H20BrFN2O4 and a molecular weight of 511.35 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126189656 |
| Molecular Formula | C25H20BrFN2O4 |
| Molecular Weight | 511.35 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]-5-ethoxy-1-benzofuran-2-carboxamide |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3ccc(OCc4cccc(F)c4)c(Br)c3)cc2c1 |
| InChI | InChI=1S/C25H20BrFN2O4/c1-2-31-20-7-9-22-18(12-20)13-24(33-22)25(30)29-28-14-16-6-8-23(21(26)11-16)32-15-17-4-3-5-19(27)10-17/h3-14H,2,15H2,1H3,(H,29,30)/b28-14+ |
| InChIKey | BTFLJUBOQLYOCY-CCVNUDIWSA-N |
| XLogP | 6.08 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.35 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|