C26H20Cl2N2O6 — CID 126194050
4-[[2,6-dichloro-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126194050) has the molecular formula C26H20Cl2N2O6 and a molecular weight of 527.36 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dichloro-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126194050 |
| Molecular Formula | C26H20Cl2N2O6 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | 4-[[2,6-dichloro-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc2oc(C(=O)N/N=C/c3cc(Cl)c(OCc4ccc(C(=O)O)cc4)c(Cl)c3)cc2c1 |
| InChI | InChI=1S/C26H20Cl2N2O6/c1-2-34-19-7-8-22-18(11-19)12-23(36-22)25(31)30-29-13-16-9-20(27)24(21(28)10-16)35-14-15-3-5-17(6-4-15)26(32)33/h3-13H,2,14H2,1H3,(H,30,31)(H,32,33)/b29-13+ |
| InChIKey | UMZLXBDVZOFOAC-VFLNYLIXSA-N |
| XLogP | 6.18 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|