C23H28IN3O4 — CID 124533906
N-[(E)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 124533906) has the molecular formula C23H28IN3O4 and a molecular weight of 537.40 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 124533906 |
| Molecular Formula | C23H28IN3O4 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | N-[(E)-[3-ethoxy-5-iodo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)CN2CCOCC2)cc(I)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H28IN3O4/c1-3-30-21-13-19(14-25-26-22(28)15-27-8-10-29-11-9-27)12-20(24)23(21)31-16-18-6-4-17(2)5-7-18/h4-7,12-14H,3,8-11,15-16H2,1-2H3,(H,26,28)/b25-14+ |
| InChIKey | JSFIKIBHFPHYNV-AFUMVMLFSA-N |
| XLogP | 3.36 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|