C16H19Br2N3O3 — CID 6162667
N-[(Z)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 6162667) has the molecular formula C16H19Br2N3O3 and a molecular weight of 461.15 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 6162667 |
| Molecular Formula | C16H19Br2N3O3 |
| Molecular Weight | 461.15 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-4-prop-2-enoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)CN2CCOCC2)cc1Br |
| InChI | InChI=1S/C16H19Br2N3O3/c1-2-5-24-16-13(17)8-12(9-14(16)18)10-19-20-15(22)11-21-3-6-23-7-4-21/h2,8-10H,1,3-7,11H2,(H,20,22)/b19-10- |
| InChIKey | ZVAQNGBBKSGXEC-GRSHGNNSSA-N |
| XLogP | 2.56 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|