C21H37N7OS2 — CID 162741292
1-[(E)-[(2E)-1-[5-[(dibutylamino)methyl]furan-2-yl]-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea (PubChem CID 162741292) has the molecular formula C21H37N7OS2 and a molecular weight of 467.71 g/mol. Its IUPAC name is 1-[(E)-[(2E)-1-[5-[(dibutylamino)methyl]furan-2-yl]-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea.
| Compound Name | 1-[(E)-[(2E)-1-[5-[(dibutylamino)methyl]furan-2-yl]-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 162741292 |
| Molecular Formula | C21H37N7OS2 |
| Molecular Weight | 467.71 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[(E)-[(2E)-1-[5-[(dibutylamino)methyl]furan-2-yl]-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea |
| SMILES | CCCCN(CCCC)Cc1ccc(C(/C=N/NC(=S)NCC)=N/NC(=S)NCC)o1 |
| InChI | InChI=1S/C21H37N7OS2/c1-5-9-13-28(14-10-6-2)16-17-11-12-19(29-17)18(25-27-21(31)23-8-4)15-24-26-20(30)22-7-3/h11-12,15H,5-10,13-14,16H2,1-4H3,(H2,22,26,30)(H2,23,27,31)/b24-15+,25-18+ |
| InChIKey | GQZHRLXWJDXMAO-NZCNRJORSA-N |
| XLogP | 3.34 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|