C13H19NO5 — CID 82330538
5-[[butyl(2-carboxyethyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 82330538) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-[[butyl(2-carboxyethyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[butyl(2-carboxyethyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82330538 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-[[butyl(2-carboxyethyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | CCCCN(CCC(=O)O)Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C13H19NO5/c1-2-3-7-14(8-6-12(15)16)9-10-4-5-11(19-10)13(17)18/h4-5H,2-3,6-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | FZJKWJJRWAQQAO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |