C19H22N6OS2 — CID 176525051
1-ethyl-3-[(E)-[(2Z)-2-(ethylcarbamothioylhydrazinylidene)-1-(6-phenylpyran-3-yl)ethylidene]amino]thiourea (PubChem CID 176525051) has the molecular formula C19H22N6OS2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 1-ethyl-3-[(E)-[(2Z)-2-(ethylcarbamothioylhydrazinylidene)-1-(6-phenylpyran-3-yl)ethylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[(E)-[(2Z)-2-(ethylcarbamothioylhydrazinylidene)-1-(6-phenylpyran-3-yl)ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 176525051 |
| Molecular Formula | C19H22N6OS2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-ethyl-3-[(E)-[(2Z)-2-(ethylcarbamothioylhydrazinylidene)-1-(6-phenylpyran-3-yl)ethylidene]amino]thiourea |
| SMILES | CCNC(=S)N/N=C\C(=N\NC(=S)NCC)C1=COC(c2ccccc2)=C=C1 |
| InChI | InChI=1S/C19H22N6OS2/c1-3-20-18(27)24-22-12-16(23-25-19(28)21-4-2)15-10-11-17(26-13-15)14-8-6-5-7-9-14/h5-10,12-13H,3-4H2,1-2H3,(H2,20,24,27)(H2,21,25,28)/b22-12-,23-16- |
| InChIKey | LFOHNUULQSRKQL-BQNZFCSISA-N |
| XLogP | 2.41 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|