C20H30N6OS2 — CID 162741277
1-ethyl-3-[[(2E)-2-(ethylcarbamothioylhydrazinylidene)-5-(2-phenylmethoxyethyl)cyclopentylidene]amino]thiourea (PubChem CID 162741277) has the molecular formula C20H30N6OS2 and a molecular weight of 434.64 g/mol. Its IUPAC name is 1-ethyl-3-[[(2E)-2-(ethylcarbamothioylhydrazinylidene)-5-(2-phenylmethoxyethyl)cyclopentylidene]amino]thiourea.
| Compound Name | 1-ethyl-3-[[(2E)-2-(ethylcarbamothioylhydrazinylidene)-5-(2-phenylmethoxyethyl)cyclopentylidene]amino]thiourea |
|---|---|
| PubChem CID | 162741277 |
| Molecular Formula | C20H30N6OS2 |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-ethyl-3-[[(2E)-2-(ethylcarbamothioylhydrazinylidene)-5-(2-phenylmethoxyethyl)cyclopentylidene]amino]thiourea |
| SMILES | CCNC(=S)NN=C1/C(=N/NC(=S)NCC)CCC1CCOCc1ccccc1 |
| InChI | InChI=1S/C20H30N6OS2/c1-3-21-19(28)25-23-17-11-10-16(18(17)24-26-20(29)22-4-2)12-13-27-14-15-8-6-5-7-9-15/h5-9,16H,3-4,10-14H2,1-2H3,(H2,21,25,28)(H2,22,26,29)/b23-17+,24-18? |
| InChIKey | NFCJCOCXUMBWDA-AALPEOGESA-N |
| XLogP | 2.68 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|