C27H44N6O2S2 — CID 162741343
benzyl (7Z,8E)-3-ethyl-7,8-bis(ethylcarbamothioylhydrazinylidene)-6-propylnonanoate (PubChem CID 162741343) has the molecular formula C27H44N6O2S2 and a molecular weight of 548.82 g/mol. Its IUPAC name is benzyl (7Z,8E)-3-ethyl-7,8-bis(ethylcarbamothioylhydrazinylidene)-6-propylnonanoate.
| Compound Name | benzyl (7Z,8E)-3-ethyl-7,8-bis(ethylcarbamothioylhydrazinylidene)-6-propylnonanoate |
|---|---|
| PubChem CID | 162741343 |
| Molecular Formula | C27H44N6O2S2 |
| Molecular Weight | 548.82 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | benzyl (7Z,8E)-3-ethyl-7,8-bis(ethylcarbamothioylhydrazinylidene)-6-propylnonanoate |
| SMILES | CCCC(CCC(CC)CC(=O)OCc1ccccc1)C(=N/NC(=S)NCC)/C(C)=N/NC(=S)NCC |
| InChI | InChI=1S/C27H44N6O2S2/c1-6-13-23(17-16-21(7-2)18-24(34)35-19-22-14-11-10-12-15-22)25(31-33-27(37)29-9-4)20(5)30-32-26(36)28-8-3/h10-12,14-15,21,23H,6-9,13,16-19H2,1-5H3,(H2,28,32,36)(H2,29,33,37)/b30-20+,31-25+ |
| InChIKey | ATBHNYDANMGZPT-GLEDKIADSA-N |
| XLogP | 5.04 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.82 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|