C12H17ClN6S3 — CID 162741304
1-[(Z)-[(2Z)-1-(5-chlorothiophen-2-yl)-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea (PubChem CID 162741304) has the molecular formula C12H17ClN6S3 and a molecular weight of 376.96 g/mol. Its IUPAC name is 1-[(Z)-[(2Z)-1-(5-chlorothiophen-2-yl)-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[(2Z)-1-(5-chlorothiophen-2-yl)-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 162741304 |
| Molecular Formula | C12H17ClN6S3 |
| Molecular Weight | 376.96 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[(Z)-[(2Z)-1-(5-chlorothiophen-2-yl)-2-(ethylcarbamothioylhydrazinylidene)ethylidene]amino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\C(=N\NC(=S)NCC)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H17ClN6S3/c1-3-14-11(20)18-16-7-8(9-5-6-10(13)22-9)17-19-12(21)15-4-2/h5-7H,3-4H2,1-2H3,(H2,14,18,20)(H2,15,19,21)/b16-7-,17-8- |
| InChIKey | SAQRGQSWOJBSJQ-DNRQYRRUSA-N |
| XLogP | 2.06 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.96 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|