C19H31N7O2S2 — CID 162740931
1-methyl-3-[(Z)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-1-[5-[(3,3,5,5-tetramethylmorpholin-4-yl)methyl]furan-2-yl]ethylidene]amino]thiourea (PubChem CID 162740931) has the molecular formula C19H31N7O2S2 and a molecular weight of 453.64 g/mol. Its IUPAC name is 1-methyl-3-[(Z)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-1-[5-[(3,3,5,5-tetramethylmorpholin-4-yl)methyl]furan-2-yl]ethylidene]amino]thiourea.
| Compound Name | 1-methyl-3-[(Z)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-1-[5-[(3,3,5,5-tetramethylmorpholin-4-yl)methyl]furan-2-yl]ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 162740931 |
| Molecular Formula | C19H31N7O2S2 |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 1-methyl-3-[(Z)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-1-[5-[(3,3,5,5-tetramethylmorpholin-4-yl)methyl]furan-2-yl]ethylidene]amino]thiourea |
| SMILES | CNC(=S)N/N=C(/C=N/NC(=S)NC)c1ccc(CN2C(C)(C)COCC2(C)C)o1 |
| InChI | InChI=1S/C19H31N7O2S2/c1-18(2)11-27-12-19(3,4)26(18)10-13-7-8-15(28-13)14(23-25-17(30)21-6)9-22-24-16(29)20-5/h7-9H,10-12H2,1-6H3,(H2,20,24,29)(H2,21,25,30)/b22-9+,23-14- |
| InChIKey | VECLVLZEODWEQR-INSJRTOLSA-N |
| XLogP | 1.55 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|