C21H29N3O3 — CID 74230966
N-[2-(4-ethoxyphenyl)ethyl]-5-[(4-methylpiperazin-1-yl)methyl]furan-2-carboxamide (PubChem CID 74230966) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)ethyl]-5-[(4-methylpiperazin-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-ethoxyphenyl)ethyl]-5-[(4-methylpiperazin-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 74230966 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)ethyl]-5-[(4-methylpiperazin-1-yl)methyl]furan-2-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(CN3CCN(C)CC3)o2)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-3-26-18-6-4-17(5-7-18)10-11-22-21(25)20-9-8-19(27-20)16-24-14-12-23(2)13-15-24/h4-9H,3,10-16H2,1-2H3,(H,22,25) |
| InChIKey | XXNMEOZLUBYHJF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |