C17H16ClN3S — CID 6253079
[(Z)-[(Z)-4-(4-chlorophenyl)-3-phenylbut-3-en-2-ylidene]amino]thiourea (PubChem CID 6253079) has the molecular formula C17H16ClN3S and a molecular weight of 329.86 g/mol. Its IUPAC name is [(Z)-[(Z)-4-(4-chlorophenyl)-3-phenylbut-3-en-2-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(Z)-4-(4-chlorophenyl)-3-phenylbut-3-en-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 6253079 |
| Molecular Formula | C17H16ClN3S |
| Molecular Weight | 329.86 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | [(Z)-[(Z)-4-(4-chlorophenyl)-3-phenylbut-3-en-2-ylidene]amino]thiourea |
| SMILES | CC(=N/NC(N)=S)/C(=C\c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H16ClN3S/c1-12(20-21-17(19)22)16(14-5-3-2-4-6-14)11-13-7-9-15(18)10-8-13/h2-11H,1H3,(H3,19,21,22)/b16-11+,20-12- |
| InChIKey | MBZJSPTZMQXEEL-CYUCFKLKSA-N |
| XLogP | 4.09 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|