C9H13N3S — CID 116507585
1-methyl-3-(2-pyridin-4-ylethyl)thiourea (PubChem CID 116507585) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-methyl-3-(2-pyridin-4-ylethyl)thiourea.
| Compound Name | 1-methyl-3-(2-pyridin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 116507585 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-methyl-3-(2-pyridin-4-ylethyl)thiourea |
| SMILES | CNC(=S)NCCc1ccncc1 |
| InChI | InChI=1S/C9H13N3S/c1-10-9(13)12-7-4-8-2-5-11-6-3-8/h2-3,5-6H,4,7H2,1H3,(H2,10,12,13) |
| InChIKey | LRRPQMDTBRCXLS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|