C15H16N2O2S — CID 3561930
1-[2-(3,4-dihydroxyphenyl)ethyl]-3-phenylthiourea (PubChem CID 3561930) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-phenylthiourea.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 3561930 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)ethyl]-3-phenylthiourea |
| SMILES | Oc1ccc(CCNC(=S)Nc2ccccc2)cc1O |
| InChI | InChI=1S/C15H16N2O2S/c18-13-7-6-11(10-14(13)19)8-9-16-15(20)17-12-4-2-1-3-5-12/h1-7,10,18-19H,8-9H2,(H2,16,17,20) |
| InChIKey | GLPVPNQXDNFUJO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|