C15H18N3S+ — CID 4747254
1-(5-methylpyridin-1-ium-2-yl)-3-(2-phenylethyl)thiourea (PubChem CID 4747254) has the molecular formula C15H18N3S+ and a molecular weight of 272.40 g/mol. Its IUPAC name is 1-(5-methylpyridin-1-ium-2-yl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-(5-methylpyridin-1-ium-2-yl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 4747254 |
| Molecular Formula | C15H18N3S+ |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-(5-methylpyridin-1-ium-2-yl)-3-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCc2ccccc2)[nH+]c1 |
| InChI | InChI=1S/C15H17N3S/c1-12-7-8-14(17-11-12)18-15(19)16-10-9-13-5-3-2-4-6-13/h2-8,11H,9-10H2,1H3,(H2,16,17,18,19)/p+1 |
| InChIKey | FTLVKPIQAUANGB-UHFFFAOYSA-O |
| XLogP | 2.34 |
| TPSA | 38.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|