C16H21F3N4O4 — CID 3429567
ethyl 2-[[amino(pyridin-4-yl)methylidene]amino]oxy-3,3,3-trifluoro-2-(pentanoylamino)propanoate (PubChem CID 3429567) has the molecular formula C16H21F3N4O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is ethyl 2-[[amino(pyridin-4-yl)methylidene]amino]oxy-3,3,3-trifluoro-2-(pentanoylamino)propanoate.
| Compound Name | ethyl 2-[[amino(pyridin-4-yl)methylidene]amino]oxy-3,3,3-trifluoro-2-(pentanoylamino)propanoate |
|---|---|
| PubChem CID | 3429567 |
| Molecular Formula | C16H21F3N4O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | ethyl 2-[[amino(pyridin-4-yl)methylidene]amino]oxy-3,3,3-trifluoro-2-(pentanoylamino)propanoate |
| SMILES | CCCCC(=O)NC(ON=C(N)c1ccncc1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N4O4/c1-3-5-6-12(24)22-15(16(17,18)19,14(25)26-4-2)27-23-13(20)11-7-9-21-10-8-11/h7-10H,3-6H2,1-2H3,(H2,20,23)(H,22,24) |
| InChIKey | MIRXCTGOCGHKJI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|