C16H22ClNO2 — CID 174281036
3,3-dimethylhept-1-en-2-yl N-(4-chlorophenyl)carbamate (PubChem CID 174281036) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 3,3-dimethylhept-1-en-2-yl N-(4-chlorophenyl)carbamate.
| Compound Name | 3,3-dimethylhept-1-en-2-yl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 174281036 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 3,3-dimethylhept-1-en-2-yl N-(4-chlorophenyl)carbamate |
| SMILES | C=C(OC(=O)Nc1ccc(Cl)cc1)C(C)(C)CCCC |
| InChI | InChI=1S/C16H22ClNO2/c1-5-6-11-16(3,4)12(2)20-15(19)18-14-9-7-13(17)8-10-14/h7-10H,2,5-6,11H2,1,3-4H3,(H,18,19) |
| InChIKey | ZWXWJQAACOKVOQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|