C13H15ClN2O4 — CID 124926147
[(2R)-2-cyano-1,1-dimethoxypropan-2-yl] N-(4-chlorophenyl)carbamate (PubChem CID 124926147) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is [(2R)-2-cyano-1,1-dimethoxypropan-2-yl] N-(4-chlorophenyl)carbamate.
| Compound Name | [(2R)-2-cyano-1,1-dimethoxypropan-2-yl] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 124926147 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [(2R)-2-cyano-1,1-dimethoxypropan-2-yl] N-(4-chlorophenyl)carbamate |
| SMILES | COC(OC)[C@@](C)(C#N)OC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClN2O4/c1-13(8-15,11(18-2)19-3)20-12(17)16-10-6-4-9(14)5-7-10/h4-7,11H,1-3H3,(H,16,17)/t13-/m1/s1 |
| InChIKey | GNSAVRLROWWTHZ-CYBMUJFWSA-N |
| XLogP | 2.79 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|